CAS 70724-68-4

4-(2-Ethoxypropoxy)piperidine

Description:

4-(2-Ethoxypropoxy)piperidine, with the CAS number 70724-68-4, is an organic compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This compound features an ethoxypropoxy substituent, which contributes to its solubility and reactivity. Typically, compounds like this exhibit moderate polarity due to the presence of both hydrophobic (alkyl) and hydrophilic (ether) groups, influencing their interaction with biological systems and solvents. The piperidine moiety is known for its role in various pharmacological activities, making derivatives of this compound of interest in medicinal chemistry. Additionally, the presence of the ethoxy and propoxy groups can enhance the compound's lipophilicity, potentially affecting its absorption and distribution in biological systems. Safety data and handling precautions should be considered, as with any chemical substance, due to potential toxicity or reactivity. Overall, 4-(2-Ethoxypropoxy)piperidine is a compound that may have applications in pharmaceuticals or as an intermediate in organic synthesis.

Formula: C₁₀H₂₁NO₂

InChI: InChI=1S/C10H21NO2/c1-3-12-9(2)8-13-10-4-6-11-7-5-10/h9-11H,3-8H2,1-2H3

InChI key: InChIKey=NVESPAGIUWPFCX-UHFFFAOYSA-N

SMILES: O(CC(OCC)C)C1CCNCC1

Synonyms:

• Piperidine, 4-(2-ethoxypropoxy)-
• 4-(2-Ethoxypropoxy)piperidine