
CAS 70724-71-9
:2-Methyl-1-(4-piperidinyloxy)-2-propanol
Description:
2-Methyl-1-(4-piperidinyloxy)-2-propanol, with the CAS number 70724-71-9, is a chemical compound characterized by its unique structure that includes a piperidine ring and a hydroxyl group. This compound typically exhibits properties such as being a colorless to pale yellow liquid, with a moderate to high solubility in polar solvents like water and alcohols, due to the presence of the hydroxyl group. It is often utilized in pharmaceutical and chemical research, particularly in the development of drugs and as a reagent in organic synthesis. The piperidine moiety contributes to its potential biological activity, making it of interest in medicinal chemistry. Additionally, the compound may exhibit moderate volatility and stability under standard conditions, although specific handling and storage guidelines should be followed to ensure safety and integrity. As with many organic compounds, it is essential to consider its reactivity, potential toxicity, and environmental impact during use and disposal.
Formula:C9H19NO2
InChI:InChI=1S/C9H19NO2/c1-9(2,11)7-12-8-3-5-10-6-4-8/h8,10-11H,3-7H2,1-2H3
InChI key:InChIKey=QUIGHCHKVHGMKF-UHFFFAOYSA-N
SMILES:O(CC(C)(C)O)C1CCNCC1
Synonyms:- 2-Methyl-1-(4-piperidinyloxy)-2-propanol
- 2-Propanol, 2-methyl-1-(4-piperidinyloxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.