CAS 70724-73-1

4-[2-(1-Methylethoxy)ethyl]piperidine

Description:

4-[2-(1-Methylethoxy)ethyl]piperidine, with the CAS number 70724-73-1, is an organic compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This compound features a side chain that includes a 1-methylethoxy group, contributing to its unique chemical properties. Typically, compounds like this may exhibit moderate polarity due to the presence of the ether functional group, which can influence solubility in various solvents. The piperidine moiety often imparts basicity, allowing the compound to participate in various chemical reactions, including nucleophilic substitutions. Additionally, the presence of the ethoxy group may enhance the compound's lipophilicity, potentially affecting its biological activity and interactions with other molecules. Such compounds are often studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. However, specific safety and handling information should be consulted from reliable sources, as the toxicity and environmental impact can vary based on the compound's structure and functional groups.

Formula: C₁₀H₂₁NO

InChI: InChI=1S/C10H21NO/c1-9(2)12-8-5-10-3-6-11-7-4-10/h9-11H,3-8H2,1-2H3

InChI key: InChIKey=BEYQXDFWFKEGHA-UHFFFAOYSA-N

SMILES: C(COC(C)C)C1CCNCC1

Synonyms:

• Piperidine, 4-[2-(1-methylethoxy)ethyl]-
• 4-[2-(1-Methylethoxy)ethyl]piperidine