CAS 7073-64-5
:(2S,3S)-N-[4-[(Aminoiminomethyl)amino]butyl]-5-[(1E)-3-[[4-[(aminoiminomethyl)amino]butyl]amino]-3-oxo-1-propen-1-yl]-2,3-dihydro-2-(4-hydroxyphenyl)-3-benzofurancarboxamide
Description:
The chemical substance with the name "(2S,3S)-N-[4-[(Aminoiminomethyl)amino]butyl]-5-[(1E)-3-[[4-[(aminoiminomethyl)amino]butyl]amino]-3-oxo-1-propen-1-yl]-2,3-dihydro-2-(4-hydroxyphenyl)-3-benzofurancarboxamide" and CAS number "7073-64-5" is a complex organic compound characterized by its intricate structure, which includes multiple functional groups such as amines, hydroxyls, and a benzofuran moiety. This compound is likely to exhibit significant biological activity due to its multiple amino groups, which can participate in hydrogen bonding and interactions with biological macromolecules. The presence of a hydroxyl group suggests potential solubility in polar solvents, while the benzofuran structure may contribute to its pharmacological properties. Additionally, the stereochemistry indicated by the (2S,3S) configuration suggests specific spatial arrangements that could influence its reactivity and interaction with biological targets. Overall, this compound's unique structural features may make it of interest in medicinal chemistry and drug development, although specific applications would depend on further research and characterization.
Formula:C28H38N8O4
InChI:InChI=1S/C28H38N8O4/c29-27(30)35-15-3-1-13-33-23(38)12-6-18-5-11-22-21(17-18)24(25(40-22)19-7-9-20(37)10-8-19)26(39)34-14-2-4-16-36-28(31)32/h5-12,17,24-25,37H,1-4,13-16H2,(H,33,38)(H,34,39)(H4,29,30,35)(H4,31,32,36)/b12-6+/t24-,25+/m0/s1
InChI key:InChIKey=KVYNYRIOAYQBFK-AIIPJEMGSA-N
SMILES:C(NCCCCNC(=N)N)(=O)[C@H]1C=2C(O[C@@H]1C3=CC=C(O)C=C3)=CC=C(/C=C/C(NCCCCNC(=N)N)=O)C2
Synonyms:- Hordatine A
- 3-Benzofurancarboxamide, N-[4-[(aminoiminomethyl)amino]butyl]-5-[(1E)-3-[[4-[(aminoiminomethyl)amino]butyl]amino]-3-oxo-1-propen-1-yl]-2,3-dihydro-2-(4-hydroxyphenyl)-, (2S,3S)-
- 3-Benzofurancarboxamide, N-[4-[(aminoiminomethyl)amino]butyl]-5-[3-[[4-[(aminoiminomethyl)amino]butyl]amino]-3-oxo-1-propenyl]-2,3-dihydro-2-(4-hydroxyphenyl)-, [2α,3β,5(E)]-(+)-
- 3-Benzofurancarboxamide, N-[4-[(aminoiminomethyl)amino]butyl]-5-[(1E)-3-[[4-[(aminoiminomethyl)amino]butyl]amino]-3-oxo-1-propenyl]-2,3-dihydro-2-(4-hydroxyphenyl)-, (2S,3S)-
- (2S,3S)-N-[4-[(Aminoiminomethyl)amino]butyl]-5-[(1E)-3-[[4-[(aminoiminomethyl)amino]butyl]amino]-3-oxo-1-propen-1-yl]-2,3-dihydro-2-(4-hydroxyphenyl)-3-benzofurancarboxamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Hordatine A
CAS:Hordatine A is a natural antifungal compound, which is a phenolic compound isolated from the barley plant, Hordeum vulgare. Its primary source is the seeds and green tissues of barley, where it functions as a secondary metabolite involved in the plant's defense mechanisms.The mode of action of Hordatine A involves the disruption of fungal cell membranes, inhibiting the growth and proliferation of fungal pathogens. It achieves this by integrating into the lipid bilayer of fungal cells, leading to increased permeability and ultimately, cell death. This mechanism highlights its potential specificity and efficacy as a biocidal agent.In terms of applications, Hordatine A is studied for its utility in agricultural settings as a natural fungicide to protect crops from fungal infestation. Its role extends to potential applications in food preservation and medicine, leveraging its antifungal properties to extend shelf life and develop treatments for fungal infections. The compound's natural origin and specific action underscore its promise as an environmentally friendly alternative to synthetic fungicides in integrated pest management strategies.Formula:C28H38N8O4Purity:Min. 95%Molecular weight:550.7 g/mol

