CAS 70733-87-8

(6Z)-2-methoxy-6-[morpholin-4-yl(sulfanyl)methylidene]cyclohexa-2,4-dien-1-one

Description:

(6Z)-2-methoxy-6-[morpholin-4-yl(sulfanyl)methylidene]cyclohexa-2,4-dien-1-one is a chemical compound characterized by its unique structural features, including a cyclohexadiene core and a morpholine moiety. The presence of a methoxy group and a sulfanyl substituent contributes to its reactivity and potential biological activity. This compound may exhibit properties such as antioxidant, antimicrobial, or anticancer activities, which are common in compounds with similar structural motifs. The morpholine ring enhances solubility and may influence the compound's interaction with biological targets. Additionally, the specific configuration indicated by the "(6Z)" designation suggests a particular geometric arrangement that can affect the compound's stability and reactivity. As a synthetic organic compound, it may be of interest in medicinal chemistry and drug development, although detailed studies would be necessary to fully elucidate its properties and potential applications. Safety and handling precautions should be observed, as with any chemical substance, particularly those with complex functional groups.

Formula: C₁₂H₁₅NO₃S

InChI: InChI=1/C12H15NO3S/c1-15-10-4-2-3-9(11(10)14)12(17)13-5-7-16-8-6-13/h2-4,17H,5-8H2,1H3/b12-9-