CAS 707340-73-6
:1,4-Bis(4-amino-2-trifluoromethylphenoxy)-2,5-di-tert-butylbenzene
Description:
1,4-Bis(4-amino-2-trifluoromethylphenoxy)-2,5-di-tert-butylbenzene is a synthetic organic compound characterized by its complex molecular structure, which includes multiple functional groups and substituents. This compound features a central benzene ring substituted with tert-butyl groups, enhancing its hydrophobic properties and thermal stability. The presence of amino groups contributes to its potential reactivity, making it suitable for various applications in materials science and organic synthesis. The trifluoromethyl groups attached to the phenoxy moieties impart unique electronic properties, which can influence the compound's behavior in chemical reactions and interactions with other substances. Additionally, the compound's structure suggests potential applications in the development of advanced polymers, dyes, or pharmaceuticals, where specific interactions and stability are crucial. Its CAS number, 707340-73-6, allows for easy identification and reference in chemical databases. Overall, this compound exemplifies the intricate design often found in specialty chemicals, combining multiple functional groups to achieve desired properties for specific applications.
Formula:C28H30F6N2O2
InChI:InChI=1/C28H30F6N2O2/c1-25(2,3)17-13-24(38-22-10-8-16(36)12-20(22)28(32,33)34)18(26(4,5)6)14-23(17)37-21-9-7-15(35)11-19(21)27(29,30)31/h7-14H,35-36H2,1-6H3
SMILES:CC(C)(C)c1cc(c(cc1Oc1ccc(cc1C(F)(F)F)N)C(C)(C)C)Oc1ccc(cc1C(F)(F)F)N
Synonyms:- 4,4'-[[2,5-Bis(tert-butyl)-1,4-phenylene]bis(oxy)]bis[3-(trifluoromethyl)benzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.