CymitQuimica logo

CAS 70736-27-5

:

methyl (2Z)-chloro[2-(4-methoxyphenyl)hydrazinylidene]ethanoate

Description:
Methyl (2Z)-chloro[2-(4-methoxyphenyl)hydrazinylidene]ethanoate, with the CAS number 70736-27-5, is a chemical compound characterized by its unique structural features. It contains a hydrazine moiety, which is indicative of its potential reactivity and biological activity. The presence of a methoxy group attached to a phenyl ring suggests that the compound may exhibit aromatic properties, potentially influencing its solubility and interaction with other molecules. The chloro substituent adds to its reactivity, making it a candidate for various chemical transformations. This compound is likely to be a solid or liquid at room temperature, depending on its molecular weight and intermolecular forces. Its functional groups may impart specific characteristics such as polarity, which can affect its solubility in different solvents. Additionally, the compound may have applications in medicinal chemistry or as an intermediate in organic synthesis, although specific applications would depend on further research into its biological activity and reactivity. Safety data and handling precautions should be considered due to the presence of reactive functional groups.
Formula:C10H11ClN2O3
InChI:InChI=1/C10H11ClN2O3/c1-15-8-5-3-7(4-6-8)12-13-9(11)10(14)16-2/h3-6,12H,1-2H3/b13-9-
Synonyms:
  • Acetic acid, 2-chloro-2-[2-(4-methoxyphenyl)hydrazinylidene]-, methyl ester
  • Methyl (Z)-2-chloro-2-(2-(4-methoxyphenyl)hydrazono)acetate
  • Methyl 2-chloro-2-(2-(4-methoxyphenyl)hydrazono)acetate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.