CAS 70746-05-3
:3,4-Dihydro-5-hydroxy-2(1H)-isoquinolinecarboximidamide
Description:
3,4-Dihydro-5-hydroxy-2(1H)-isoquinolinecarboximidamide, with the CAS number 70746-05-3, is a chemical compound that belongs to the class of isoquinoline derivatives. This substance features a bicyclic structure that includes a dihydroisoquinoline core, which is characterized by its fused ring system. The presence of a hydroxyl group at the 5-position contributes to its potential reactivity and solubility in polar solvents. The carboximidamide functional group indicates that the compound may exhibit properties typical of amides, such as hydrogen bonding capabilities, which can influence its biological activity and interactions with other molecules. This compound may be of interest in medicinal chemistry due to its structural features, which could be relevant for developing pharmaceuticals or studying biological pathways. However, specific applications, biological activities, and safety profiles would require further investigation through empirical studies and literature reviews.
Formula:C10H13N3O
InChI:InChI=1S/C10H13N3O/c11-10(12)13-5-4-8-7(6-13)2-1-3-9(8)14/h1-3,14H,4-6H2,(H3,11,12)
InChI key:InChIKey=NDFYJSUPIOLUTI-UHFFFAOYSA-N
SMILES:OC1=C2C(CN(C(=N)N)CC2)=CC=C1
Synonyms:- 2(1H)-Isoquinolinecarboximidamide, 3,4-dihydro-5-hydroxy-
- 5-Hydroxydebrisoquine
- 3,4-Dihydro-5-hydroxy-2(1H)-isoquinolinecarboximidamide
- 5-Hydroxydebrisoquin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.