CAS 70748-25-3
:2(3H)-Furanone, dihydro-3-methylene-, homopolymer
Description:
2(3H)-Furanone, dihydro-3-methylene-, homopolymer, identified by CAS number 70748-25-3, is a synthetic polymer derived from the polymerization of dihydro-3-methylene-2(3H)-furanone. This compound exhibits characteristics typical of furanone derivatives, including a five-membered cyclic structure containing oxygen. The polymer is generally characterized by its thermoplastic properties, which can be influenced by the degree of polymerization and the molecular weight. It is known for its potential applications in various fields, including coatings, adhesives, and biomedical materials, due to its biocompatibility and biodegradability. The polymer may also exhibit good mechanical strength and flexibility, making it suitable for diverse applications. Additionally, its chemical structure allows for further functionalization, enabling the incorporation of various functional groups to tailor its properties for specific uses. Overall, this homopolymer represents a versatile material with promising applications in both industrial and consumer products.
Formula:(C5H6O2)x
InChI:InChI=1S/C5H6O2/c1-4-2-3-7-5(4)6/h1-3H2
InChI key:InChIKey=GSLDEZOOOSBFGP-UHFFFAOYSA-N
SMILES:C=C1C(=O)OCC1
Synonyms:- 2(3H)-Furanone, dihydro-3-methylene-, homopolymer
- α-Methylenebutyrolactone homopolymer
- Tulipalin A homopolymer
- α-Methylene-γ-butyrolactone homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
