
CAS 70748-29-7
:Poly(acrylamidoglycolic acid)
Description:
Poly(acrylamidoglycolic acid) is a synthetic polymer characterized by its hydrophilic nature, which arises from the presence of both amide and carboxylic acid functional groups in its structure. This polymer is typically produced through the polymerization of acrylamido and glycolic acid monomers, resulting in a water-soluble compound. Its unique properties include high biocompatibility and biodegradability, making it suitable for various biomedical applications, such as drug delivery systems and tissue engineering. The presence of carboxylic acid groups allows for the formation of hydrogels, which can absorb significant amounts of water, providing a soft and flexible material ideal for medical uses. Additionally, poly(acrylamidoglycolic acid) can be modified to enhance its properties, such as increasing its mechanical strength or altering its degradation rate. Overall, this polymer's versatility and functional characteristics make it an important material in both research and industrial applications.
Formula:(C5H7NO4)x
InChI:InChI=1S/C5H7NO4/c1-2-3(7)6-4(8)5(9)10/h2,4,8H,1H2,(H,6,7)(H,9,10)
InChI key:InChIKey=NEYTXADIGVEHQD-UHFFFAOYSA-N
SMILES:N(C(C(O)=O)O)C(C=C)=O
Synonyms:- Acetic acid, 2-hydroxy-N-[(1-oxo-2-propen-1-yl)amino]-, homopolymer
- Poly(acrylamidoglycolic acid)
- Poly(acrylamido N-glycolic acid)
- 2-Hydroxy-2-[(1-oxoprop-2-enyl)amino]acetic acid homopolymer
- Acetic acid, hydroxy[(1-oxo-2-propenyl)amino]-, homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
