CAS 70752-22-6

Benzoic acid, 5-amino-2,4-dimethoxy-, methyl ester

Description:

Benzoic acid, 5-amino-2,4-dimethoxy-, methyl ester, identified by the CAS number 70752-22-6, is an organic compound characterized by its benzoic acid structure modified with amino and methoxy functional groups. This compound features a methoxy group at the 2 and 4 positions of the aromatic ring, enhancing its solubility and reactivity. The presence of the amino group at the 5 position contributes to its potential as a building block in organic synthesis and pharmaceuticals. Typically, compounds of this nature exhibit moderate polarity due to the combination of hydrophobic aromatic and hydrophilic functional groups, which can influence their solubility in various solvents. Additionally, the methyl ester functional group suggests that it may undergo hydrolysis to release benzoic acid and methanol under appropriate conditions. This compound may also exhibit biological activity, making it of interest in medicinal chemistry. Overall, its unique structure allows for diverse applications in chemical synthesis and potential therapeutic uses.

Formula: C₁₀H₁₃NO₄

InChI: InChI=1S/C10H13NO4/c1-13-8-5-9(14-2)7(11)4-6(8)10(12)15-3/h4-5H,11H2,1-3H3

InChI key: InChIKey=RYVYYLPISGDRFX-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C(OC)C=C(OC)C(N)=C1

Synonyms:

• Methyl 5-amino-2,4-dimethoxybenzoate
• Benzoic acid, 5-amino-2,4-dimethoxy-, methyl ester