CAS 70754-93-7
:N,N-Dimethyl-1-(2-pyrrolidinyl)methanamine
Description:
N,N-Dimethyl-1-(2-pyrrolidinyl)methanamine, also known as DM-Pyrrolidine, is a chemical compound characterized by its amine functional groups and a pyrrolidine ring. It features a dimethylamino group attached to a methanamine backbone, which contributes to its basicity and potential as a nucleophile in various chemical reactions. This compound is typically a colorless to pale yellow liquid with a distinctive amine odor. It is soluble in water and organic solvents, making it versatile for use in various applications, including pharmaceuticals and organic synthesis. The presence of the pyrrolidine ring enhances its structural stability and can influence its biological activity, making it of interest in medicinal chemistry. Safety considerations include handling it in well-ventilated areas and using appropriate personal protective equipment, as it may cause irritation to the skin and eyes. Overall, N,N-Dimethyl-1-(2-pyrrolidinyl)methanamine is a significant compound in both industrial and research settings due to its unique chemical properties.
Formula:C7H16N2
InChI:InChI=1S/C7H16N2/c1-9(2)6-7-4-3-5-8-7/h7-8H,3-6H2,1-2H3
SMILES:CN(C)CC1CCCN1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
