CAS 70757-44-7
:2,4,5-Trichloro-6-bromophenol
Description:
2,4,5-Trichloro-6-bromophenol is an organic compound characterized by its halogenated phenolic structure. It features three chlorine atoms and one bromine atom attached to a phenolic ring, which contributes to its chemical reactivity and potential applications. This compound is typically a solid at room temperature and may exhibit a range of colors depending on its purity and form. It is known for its antimicrobial properties, making it useful in various industrial applications, including as a biocide and in the formulation of pesticides. The presence of multiple halogen substituents enhances its stability and lipophilicity, which can influence its behavior in biological systems and the environment. Additionally, 2,4,5-Trichloro-6-bromophenol may pose environmental and health risks due to its potential toxicity and persistence. Proper handling and disposal are essential to mitigate any adverse effects associated with its use. As with many halogenated compounds, it is important to consider its regulatory status and safety data when working with or studying this substance.
Formula:C6H2BrCl3O
InChI:InChI=1/C6H2BrCl3O/c7-4-5(10)2(8)1-3(9)6(4)11/h1,11H
Synonyms:- 2-bromo-3,4,6-trichlorophenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.