CAS 70757-61-8
:[4-(2-phenylpropan-2-yl)phenoxy]acetic acid
Description:
[4-(2-phenylpropan-2-yl)phenoxy]acetic acid, with the CAS number 70757-61-8, is an organic compound characterized by its phenoxyacetic acid structure, which features a phenylpropan-2-yl substituent. This compound typically exhibits properties associated with both phenolic and carboxylic acid functionalities, including potential acidity due to the carboxylic acid group and hydrophobic characteristics from the phenyl groups. It may be soluble in organic solvents while showing limited solubility in water, depending on the specific conditions. The presence of the bulky isopropyl group can influence its steric properties and reactivity, potentially affecting its biological activity and interactions with other molecules. Such compounds are often studied for their applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. However, specific data regarding its reactivity, stability, and biological effects would require further investigation through empirical studies and literature reviews.
Formula:C17H18O3
InChI:InChI=1/C17H18O3/c1-17(2,13-6-4-3-5-7-13)14-8-10-15(11-9-14)20-12-16(18)19/h3-11H,12H2,1-2H3,(H,18,19)
SMILES:CC(C)(c1ccccc1)c1ccc(cc1)OCC(=O)O
Synonyms:- Acetic Acid, 2-[4-(1-Methyl-1-Phenylethyl)Phenoxy]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
[4-(1-methyl-1-phenylethyl)phenoxy]acetic acid
CAS:Formula:C17H18O3Purity:95%Color and Shape:SolidMolecular weight:270.32302-(4-(2-Phenylpropan-2-yl)phenoxy)acetic acid
CAS:2-(4-(2-Phenylpropan-2-yl)phenoxy)acetic acidPurity:95%Molecular weight:270.33g/mol[4-(1-methyl-1-phenylethyl)phenoxy]acetic acid
CAS:Formula:C17H18O3Purity:95%Color and Shape:SolidMolecular weight:270.328[4-(1-Methyl-1-phenylethyl)phenoxy]acetic acid
CAS:4-(1-Methyl-1-phenylethyl)phenoxyacetic acid is a versatile building block that is used in the synthesis of a variety of fine chemicals and drugs. 4-(1-Methyl-1-phenylethyl)phenoxyacetic acid is an intermediate in the synthesis of a number of complex compounds, including research chemicals, reagents, and speciality chemicals. This compound can also be used as a reaction component for the synthesis of other chemical compounds or as a scaffold for larger molecules.
Formula:C17H18O3Purity:Min. 95%Color and Shape:PowderMolecular weight:270.32 g/molRef: 3D-FM112689
Discontinued product



