CAS 70758-92-8

5-fluoro-1-(1-oxidotetrahydrothiophen-2-yl)pyrimidine-2,4(1H,3H)-dione

Description:

5-Fluoro-1-(1-oxidotetrahydrothiophen-2-yl)pyrimidine-2,4(1H,3H)-dione, with the CAS number 70758-92-8, is a heterocyclic compound characterized by its pyrimidine core, which is substituted with a fluorine atom and a tetrahydrothiophene moiety. This compound features a dione functional group, indicating the presence of two carbonyl (C=O) groups, which contribute to its reactivity and potential biological activity. The presence of the fluorine atom can enhance lipophilicity and influence the compound's pharmacokinetic properties. The tetrahydrothiophene ring adds to the molecular complexity and may impart unique chemical properties, such as increased stability or specific interactions with biological targets. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can modulate biological activity. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its properties can be explored through various analytical methods, including NMR, mass spectrometry, and chromatography.

Formula: C₈H₉FN₂O₃S

InChI: InChI=1/C8H9FN2O3S/c9-5-4-11(8(13)10-7(5)12)6-2-1-3-15(6)14/h4,6H,1-3H2,(H,10,12,13)

SMILES: C1CC(n2cc(c(nc2=O)O)F)S(=O)C1

Synonyms:

• 2,4(1H,3H)-pyrimidinedione, 5-fluoro-1-(tetrahydro-1-oxido-2-thienyl)-