CymitQuimica logo

CAS 7076-17-7

:

1,3,4,5-tetrahydrothiopyrano[4,3-b]indole

Description:
1,3,4,5-Tetrahydrothiopyrano[4,3-b]indole is a heterocyclic organic compound characterized by its unique bicyclic structure that incorporates both a thiopyran and an indole moiety. This compound features a saturated tetrahydrothiopyran ring fused to an indole, which contributes to its potential biological activity. The presence of sulfur in the thiopyran ring can influence the compound's reactivity and solubility, making it of interest in medicinal chemistry. Typically, compounds of this nature may exhibit various pharmacological properties, including antimicrobial or anticancer activities, although specific biological data would depend on empirical studies. The molecular structure allows for potential interactions with biological targets, making it a candidate for further research in drug development. Additionally, the compound's stability, solubility, and reactivity can be influenced by the functional groups present and the overall electronic environment of the molecule. As with many heterocycles, its synthesis and characterization are crucial for understanding its properties and potential applications in various fields, including pharmaceuticals and materials science.
Formula:C11H11NS
InChI:InChI=1/C11H11NS/c1-2-4-10-8(3-1)9-7-13-6-5-11(9)12-10/h1-4,12H,5-7H2
SMILES:c1ccc2c(c1)c1CSCCc1[nH]2
Synonyms:
  • Thiopyrano[4,3-B]Indole, 1,3,4,5-Tetrahydro-
  • 1,3,4,5-TETRAHYDROTHIOPYRANO[4,3-B]INDOLE
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.