CymitQuimica logo

CAS 70776-89-5

:

4-(1,1-Di-2-buten-1-yl-3-penten-1-yl)pyridine

Description:
4-(1,1-Di-2-buten-1-yl-3-penten-1-yl)pyridine, with CAS number 70776-89-5, is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features a complex aliphatic side chain that includes multiple double bonds, specifically two 2-butenyl groups and a 3-pentenyl group, contributing to its reactivity and potential applications in organic synthesis. The presence of these unsaturated hydrocarbon chains may impart unique properties such as increased reactivity in polymerization reactions or as intermediates in various chemical processes. The molecular structure suggests that it may exhibit characteristics typical of both pyridine derivatives and alkenes, such as basicity due to the nitrogen atom and potential for electrophilic addition reactions. Additionally, the compound's physical properties, such as boiling point, melting point, and solubility, would depend on the specific arrangement of its substituents and the overall molecular weight. Its applications could span fields like pharmaceuticals, agrochemicals, or materials science, depending on its reactivity and functionalization potential.
Formula:C18H25N
InChI:InChI=1S/C18H25N/c1-4-7-12-18(13-8-5-2,14-9-6-3)17-10-15-19-16-11-17/h4-11,15-16H,12-14H2,1-3H3
InChI key:InChIKey=IZDCTQDGYOSQRY-UHFFFAOYSA-N
SMILES:C(CC=CC)(CC=CC)(CC=CC)C=1C=CN=CC1
Synonyms:
  • 4-(1,1-Di(2-butenyl)-3-pentenyl)pyridine
  • 4-(1,1-Di-2-buten-1-yl-3-penten-1-yl)pyridine
  • 4-[(3E)-1,1-di-(2E)-but-2-en-1-ylpent-3-en-1-yl]pyridine
  • Pyridine, 4-(1,1-di-2-buten-1-yl-3-penten-1-yl)-
  • Pyridine, 4-(1,1-di-2-butenyl-3-pentenyl)-
  • 4-(1,1-Dibut-2-enylpent-3-enyl)pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.