CymitQuimica logo

CAS 70783-32-3

:

2,2,2-trifluoro-1-(4-phenoxyphenyl)ethanone

Description:
2,2,2-Trifluoro-1-(4-phenoxyphenyl)ethanone, with the CAS number 70783-32-3, is an organic compound characterized by its unique trifluoromethyl group and a phenoxyphenyl moiety. This compound typically exhibits a high degree of lipophilicity due to the presence of the phenyl groups, which can influence its solubility in organic solvents. The trifluoromethyl group contributes to its chemical stability and can enhance its biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. The presence of the ketone functional group indicates that it can participate in nucleophilic addition reactions, while the phenoxy group may provide additional reactivity or interaction with biological targets. Overall, this compound's structural features suggest potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. Its properties, such as melting point, boiling point, and specific reactivity, would need to be determined through experimental methods for precise applications.
Formula:C14H9F3O2
InChI:InChI=1/C14H9F3O2/c15-14(16,17)13(18)10-6-8-12(9-7-10)19-11-4-2-1-3-5-11/h1-9H
SMILES:c1ccc(cc1)Oc1ccc(cc1)C(=O)C(F)(F)F
Synonyms:
  • Ethanone, 2,2,2-trifluoro-1-(4-phenoxyphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.