CymitQuimica logo

CAS 70783-33-4

:

4-Phenoxy-α-(trifluoromethyl)benzenemethanol

Description:
4-Phenoxy-α-(trifluoromethyl)benzenemethanol, with the CAS number 70783-33-4, is an organic compound characterized by its complex structure, which includes a phenoxy group and a trifluoromethyl substituent on a benzene ring. This compound typically exhibits properties associated with both aromatic compounds and alcohols, such as moderate solubility in organic solvents and potential reactivity due to the presence of the hydroxyl (-OH) group. The trifluoromethyl group contributes to its lipophilicity and can influence its electronic properties, making it a candidate for various applications in pharmaceuticals and agrochemicals. Additionally, the presence of the phenoxy moiety may enhance its biological activity and interaction with biological targets. As with many fluorinated compounds, it may exhibit unique characteristics such as increased stability and altered reactivity compared to non-fluorinated analogs. Safety and handling precautions should be observed due to potential toxicity and environmental impact associated with fluorinated compounds.
Formula:C14H11F3O2
InChI:InChI=1S/C14H11F3O2/c15-14(16,17)13(18)10-6-8-12(9-7-10)19-11-4-2-1-3-5-11/h1-9,13,18H
InChI key:InChIKey=NNULRJTXYWIUCM-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(O)C1=CC=C(OC2=CC=CC=C2)C=C1
Synonyms:
  • 2,2,2-Trifluoro-1-(4-phenoxyphenyl)ethan-1-ol
  • Benzenemethanol, 4-phenoxy-α-(trifluoromethyl)-
  • 4-Phenoxy-α-(trifluoromethyl)benzenemethanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.