CymitQuimica logo

CAS 70783-48-1

:

2,2,2-Trifluoro-1-furan-2-yl-ethanol

Description:
2,2,2-Trifluoro-1-furan-2-yl-ethanol is a fluorinated organic compound characterized by the presence of a furan ring and a hydroxyl group. The trifluoromethyl group attached to the carbon chain significantly influences its chemical properties, enhancing its polarity and making it more soluble in polar solvents. This compound typically exhibits a high degree of stability due to the presence of the furan moiety, which contributes to its aromatic character. The trifluoromethyl group can also impart unique reactivity, making it useful in various synthetic applications, particularly in medicinal chemistry and agrochemicals. The hydroxyl group provides potential for hydrogen bonding, affecting its boiling point and solubility. Additionally, the presence of fluorine atoms can enhance the compound's lipophilicity and metabolic stability, which are important factors in drug design. Overall, 2,2,2-Trifluoro-1-furan-2-yl-ethanol is a versatile compound with applications in various fields, including pharmaceuticals and materials science.
Formula:C6H5F3O2
InChI:InChI=1/C6H5F3O2/c7-6(8,9)5(10)4-2-1-3-11-4/h1-3,5,10H
SMILES:c1cc(C(C(F)(F)F)O)oc1
Synonyms:
  • 2,2,2-trifluoro-1-(2-furanyl)ethanol
  • 2,2,2-TRIFLUORO-1-FURAN-2-YL-ETHANOL
  • 2,2,2-TRIFLUORO-1-(2-FURYL)ETHANOL
  • 2-Furanmethanol, α-(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.