CAS 70786-68-4

1-(~2~H_3_)methyl-2,4-dinitrobenzene

Description:

1-(2H3)methyl-2,4-dinitrobenzene, with the CAS number 70786-68-4, is an organic compound characterized by its aromatic structure featuring a benzene ring substituted with two nitro groups and a methyl group. The presence of the nitro groups, which are electron-withdrawing, significantly influences the compound's reactivity and properties, making it a potential candidate for various chemical reactions, including electrophilic substitution. The methyl group, being an electron-donating substituent, can also affect the compound's overall electronic distribution. This compound is typically used in research and industrial applications, particularly in the synthesis of other chemical entities. It may exhibit moderate to high toxicity, and appropriate safety measures should be taken when handling it. Additionally, its physical properties, such as solubility and melting point, are influenced by the presence of the nitro groups and the overall molecular structure. As with many nitro-substituted compounds, it may also be sensitive to heat and shock, necessitating careful storage and handling practices.

Formula: C₇H₃D₃N₂O₄

InChI: InChI=1/C7H6N2O4/c1-5-2-3-6(8(10)11)4-7(5)9(12)13/h2-4H,1H3/i1D3

SMILES: C(c1ccc(cc1N(=O)=O)N(=O)=O)([2H])([2H])[2H]

Synonyms:

• Benzene, 1-(Methyl-D_3_)-2,4-Dinitro-

2,4-Dinitrotoluene-α,α,α-d3

CAS: 70786-68-4

Formula: (NO₂)₂C₆H₃CD₃

Purity: 98 atom % D

Color and Shape: White-Pale Yellow Solid

Molecular weight: 185.05159

Ref: 3U-D5093

2,4-Dinitrotoluene-α,α,α-d3

Controlled Product

CAS: 70786-68-4

Applications 2,4-Dinitrotoluene-alpha,alpha,alpha-d3 (CAS# 70786-68-4) is a useful isotopically labeled research compound.

Formula: C₇H₃D₃N₂O₄

Color and Shape: Neat

Molecular weight: 185.15

Ref: TR-D480451