CAS 70793-10-1
:6-carboxy-8-hydroxy-9,10-dioxo-9,10-dihydroanthracen-1-yl beta-D-glucopyranosiduronic acid
Description:
6-Carboxy-8-hydroxy-9,10-dioxo-9,10-dihydroanthracen-1-yl beta-D-glucopyranosiduronic acid, with the CAS number 70793-10-1, is a complex organic compound characterized by its anthracene-derived structure, which includes multiple functional groups such as carboxylic acid, hydroxyl, and uronic acid moieties. This compound exhibits properties typical of anthraquinone derivatives, including potential applications in dyeing and as a biological agent due to its ability to interact with various biological systems. The presence of the glucopyranosiduronic acid component suggests that it may have enhanced solubility and reactivity in biological environments, making it of interest in medicinal chemistry and biochemistry. Its structural features may also contribute to its potential antioxidant and antimicrobial activities. The compound's stability, solubility, and reactivity can be influenced by pH and the presence of other ions or molecules in solution, which are important considerations for its practical applications. Overall, this compound represents a unique intersection of organic chemistry and potential therapeutic applications.
Formula:C21H16O12
InChI:InChI=1/C21H16O12/c22-9-5-6(19(28)29)4-8-11(9)14(24)12-7(13(8)23)2-1-3-10(12)32-21-17(27)15(25)16(26)18(33-21)20(30)31/h1-5,15-18,21-22,25-27H,(H,28,29)(H,30,31)/t15-,16-,17+,18-,21+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Rhein 8-β-D-Glucuronide
CAS:Controlled ProductFormula:C21H16O12Color and Shape:NeatMolecular weight:460.34Rhein 8-b-D-glucuronide
CAS:Rhein 8-b-D-glucuronide is a synthetic glycosylate that has been modified with fluorine. It is soluble in water and methanol. Rhein 8-b-D-glucuronide is used as a reagent in sugar chemistry, such as the synthesis of oligosaccharides and monosaccharides. The compound can be used to modify saccharides as well, such as methylation and Click modification. Rhein 8-b-D-glucuronide has CAS number 70793-10-1 and a high purity level of >99%.Formula:C21H16O12Purity:Min. 95%Molecular weight:460.34 g/mol



