CAS 70793-12-3

1,2-Propanediamine, N1,N1-diethyl-, (S)-

Description:

1,2-Propanediamine, N1,N1-diethyl-, (S)-, also known as diethyl-(S)-1,2-propanediamine, is an organic compound characterized by its amine functional groups. It features a propanediamine backbone with two ethyl groups attached to one of the nitrogen atoms, and it possesses chirality, indicating that it exists in a specific stereoisomeric form. This compound is typically a colorless to pale yellow liquid with a relatively low molecular weight. It is soluble in water and polar organic solvents, which is common for amines. The presence of two amine groups allows it to participate in various chemical reactions, including those typical of amines, such as nucleophilic substitutions and complexation with metal ions. Its chiral nature may impart specific biological activities, making it of interest in pharmaceutical applications. Safety data should be consulted, as amines can be irritants and may pose health risks upon exposure. Overall, 1,2-Propanediamine, N1,N1-diethyl-, (S)- is a versatile compound with potential applications in organic synthesis and medicinal chemistry.

Formula: C₇H₁₈N₂

InChI: InChI=1S/C7H18N2/c1-4-9(5-2)6-7(3)8/h7H,4-6,8H2,1-3H3/t7-/m0/s1

InChI key: InChIKey=ZGZHNQPTNCGKHS-ZETCQYMHSA-N

SMILES: N(C[C@H](C)N)(CC)CC

Synonyms:

• 1,2-Propanediamine, N1,N1-diethyl-, (S)-
• (S)-N,N-Diethyl-1,2-propanediamine