CAS 70794-11-5
:3-(4-methoxyphenyl)-1H-indole-2-carboxylic acid
Description:
3-(4-Methoxyphenyl)-1H-indole-2-carboxylic acid, identified by its CAS number 70794-11-5, is an organic compound that features a complex structure comprising an indole core substituted with a methoxyphenyl group and a carboxylic acid functional group. This compound typically exhibits characteristics common to indole derivatives, such as potential biological activity, including anti-inflammatory and anticancer properties. The presence of the methoxy group enhances its lipophilicity, which may influence its solubility and permeability in biological systems. The carboxylic acid moiety can participate in hydrogen bonding and may affect the compound's reactivity and interaction with biological targets. Additionally, this compound may be of interest in medicinal chemistry for its potential applications in drug development, particularly in the design of novel therapeutic agents. Its synthesis and characterization would involve standard organic chemistry techniques, and its properties can be further explored through various analytical methods, including spectroscopy and chromatography.
Formula:C16H13NO3
InChI:InChI=1/C16H13NO3/c1-20-11-8-6-10(7-9-11)14-12-4-2-3-5-13(12)17-15(14)16(18)19/h2-9,17H,1H3,(H,18,19)
SMILES:COc1ccc(cc1)c1c2ccccc2[nH]c1C(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
