CAS 708-16-7
:5-Methoxy-2-quinazolinamine
Description:
5-Methoxy-2-quinazolinamine is an organic compound characterized by its quinazoline core, which is a bicyclic structure containing a benzene ring fused to a pyrimidine ring. This compound features a methoxy group (-OCH3) at the 5-position and an amino group (-NH2) at the 2-position of the quinazoline ring, contributing to its chemical reactivity and potential biological activity. It is typically a crystalline solid, and its solubility can vary depending on the solvent used. The presence of the methoxy and amino groups can influence its interaction with biological targets, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound may exhibit various properties such as antimicrobial, anti-inflammatory, or anticancer activities, although specific biological effects would depend on further empirical studies. As with many organic compounds, proper handling and safety measures should be observed due to potential toxicity or reactivity.
Formula:C9H9N3O
InChI:InChI=1S/C9H9N3O/c1-13-8-4-2-3-7-6(8)5-11-9(10)12-7/h2-5H,1H3,(H2,10,11,12)
InChI key:InChIKey=CSAQZXLDYLTXHQ-UHFFFAOYSA-N
SMILES:O(C)C=1C2=C(N=C(N)N=C2)C=CC1
Synonyms:- 2-Quinazolinamine, 5-methoxy-
- 5-Methoxy-2-quinazolinamine
- Quinazoline, 2-amino-5-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.