CAS 70801-02-4
:Flutroline
Description:
Flutroline, with the CAS number 70801-02-4, is a chemical compound that belongs to the class of substances known as herbicides. It is primarily used in agricultural applications for the control of various weeds and unwanted vegetation. Flutroline functions by inhibiting specific biochemical pathways in plants, leading to their growth suppression or death. The compound is characterized by its selective action, which allows it to target certain plant species while minimizing harm to crops. Its mode of action typically involves interference with photosynthesis or other vital metabolic processes. Flutroline is generally applied in pre-emergent or post-emergent formulations, depending on the target species and the timing of application. As with many herbicides, safety and environmental impact are important considerations, and its use is regulated in many regions to prevent adverse effects on non-target organisms and ecosystems. Proper handling and application guidelines are essential to maximize efficacy while minimizing risks associated with chemical exposure.
Formula:C27H25F3N2O
InChI:InChI=1/C27H25F3N2O/c28-19-5-3-18(4-6-19)27(33)2-1-14-31-15-13-26-24(17-31)23-16-21(30)9-12-25(23)32(26)22-10-7-20(29)8-11-22/h3-12,16,27,33H,1-2,13-15,17H2
SMILES:C(CC(c1ccc(cc1)F)O)CN1CCc2c(C1)c1cc(ccc1n2c1ccc(cc1)F)F
Synonyms:- Flutroline [USAN:INN]
- (+-)-8-Fluoro-alpha,5-bis(p-fluorophenyl)-1,3,4,5-tetrahydro-2H-pyrido(4,3-b)indole-2-butanol
- 2H-Pyrido(4,3-b)indole-2-butanol, 8-fluoro-alpha,5-bis(4-fluorophenyl)-1,3,4,5-tetrahydro-, (+-)-
- Cp 36,584
- Flutrolino
- Flutrolino [INN-Spanish]
- Flutrolinum
- Flutrolinum [INN-Latin]
- Unii-J922111J7P
- 4-[8-fluoro-5-(4-fluorophenyl)-1,3,4,5-tetrahydro-2H-pyrido[4,3-b]indol-2-yl]-1-(4-fluorophenyl)butan-1-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Flutroline
CAS:Flutroline is a gamma-carboline antipsychotic agent.Formula:C27H25F3N2OColor and Shape:SolidMolecular weight:450.5
