CAS 708273-40-9

tert-butyl (3S,4S)-3-amino-4-ethoxy-pyrrolidine-1-carboxylate

Description:

Tert-butyl (3S,4S)-3-amino-4-ethoxy-pyrrolidine-1-carboxylate is a chemical compound characterized by its pyrrolidine structure, which includes an amino group and an ethoxy substituent. This compound features a tert-butyl ester group, contributing to its stability and solubility in organic solvents. The presence of stereocenters at the 3 and 4 positions of the pyrrolidine ring indicates that it exists in specific stereoisomeric forms, which can influence its biological activity and interactions. The amino group suggests potential for hydrogen bonding, making it relevant in various chemical reactions and applications, particularly in medicinal chemistry. The ethoxy group enhances lipophilicity, which can affect the compound's pharmacokinetics. Overall, this compound may serve as a valuable intermediate in the synthesis of pharmaceuticals or other bioactive molecules, with its unique structural features allowing for targeted modifications and applications in drug development.

Formula: C₁₁H₂₂N₂O₃

InChI: InChI=1/C11H22N2O3/c1-5-15-9-7-13(6-8(9)12)10(14)16-11(2,3)4/h8-9H,5-7,12H2,1-4H3/t8-,9-/m0/s1

SMILES: CCO[C@H]1CN(C[C@@H]1N)C(=O)OC(C)(C)C

Synonyms:

• tert-Butyl (3S,4S)-3-amino-4-ethoxypyrrolidine-1-carboxylate