CAS 708295-12-9

[3-(cyclopropylcarbonyl)-1H-indol-1-yl]acetic acid

Description:

[3-(Cyclopropylcarbonyl)-1H-indol-1-yl]acetic acid, with the CAS number 708295-12-9, is a chemical compound that features an indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound is characterized by the presence of a cyclopropylcarbonyl group attached to the indole nitrogen, along with an acetic acid functional group. The cyclopropyl group contributes to the compound's unique steric and electronic properties, potentially influencing its biological activity. The indole moiety is known for its role in various biological systems and can exhibit diverse pharmacological effects. The acetic acid portion of the molecule may enhance solubility and reactivity. Overall, this compound may be of interest in medicinal chemistry and drug development, particularly for its potential therapeutic applications. Its specific characteristics, such as solubility, stability, and reactivity, would depend on the molecular interactions and the environment in which it is studied.

Formula: C₁₄H₁₃NO₃

InChI: InChI=1/C14H13NO3/c16-13(17)8-15-7-11(14(18)9-5-6-9)10-3-1-2-4-12(10)15/h1-4,7,9H,5-6,8H2,(H,16,17)

SMILES: c1ccc2c(c1)c(cn2CC(=O)O)C(=O)C1CC1

(3-Cyclopropanecarbonyl-indol-1-yl)-acetic acid

Controlled Product

CAS: 708295-12-9

Please enquire for more information about (3-Cyclopropanecarbonyl-indol-1-yl)-acetic acid including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₄H₁₃NO₃

Purity: Min. 95%

Molecular weight: 243.26 g/mol

Ref: 3D-IDB29512