CAS 7083-63-8
:9H-Fluoren-4-amine
Description:
9H-Fluoren-4-amine, with the CAS number 7083-63-8, is an organic compound characterized by its structure, which features a fluorenyl group substituted with an amino group at the 4-position. This compound is typically a white to off-white solid and is known for its aromatic properties due to the presence of the fluorenyl moiety. It is soluble in organic solvents such as ethanol and dichloromethane but has limited solubility in water. 9H-Fluoren-4-amine is often utilized in organic synthesis, particularly in the production of dyes, pharmaceuticals, and as a building block for various chemical reactions, including coupling reactions and the synthesis of more complex organic molecules. The amino group can participate in hydrogen bonding, influencing its reactivity and interactions with other chemical species. Additionally, this compound may exhibit biological activity, making it of interest in medicinal chemistry. Proper handling and safety measures should be observed, as with many amines, due to potential toxicity and reactivity.
Formula:C13H11N
InChI:InChI=1S/C13H11N/c14-12-7-3-5-10-8-9-4-1-2-6-11(9)13(10)12/h1-7H,8,14H2
InChI key:InChIKey=NNHRVRJFHLVIIV-UHFFFAOYSA-N
SMILES:NC1=C2C=3C(CC2=CC=C1)=CC=CC3
Synonyms:- 9H-Fluoren-4-amine
- Fluoren-4-amine
- NSC 90664
- 4-Aminofluorene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.