CAS 70831-94-6: [(3S,4R,5S,6S)-3,4-diacetoxy-6-bromo-5-(1,3-dioxoisoindolin-2-yl)tetrahydropyran-2-yl]methyl acetate
Description:The chemical substance with the name "[(3S,4R,5S,6S)-3,4-diacetoxy-6-bromo-5-(1,3-dioxoisoindolin-2-yl)tetrahydropyran-2-yl]methyl acetate" and CAS number 70831-94-6 is a complex organic compound characterized by its specific stereochemistry and functional groups. It features a tetrahydropyran ring, which is a six-membered cyclic ether, and includes multiple acetoxy groups that enhance its reactivity and solubility in organic solvents. The presence of a bromine atom introduces halogen characteristics, which can influence the compound's reactivity and potential applications in synthesis. Additionally, the isoindolin-2-yl moiety contributes to the compound's biological activity, making it of interest in medicinal chemistry. The stereochemical configuration (3S, 4R, 5S, 6S) indicates the specific spatial arrangement of atoms, which is crucial for the compound's interaction with biological targets. Overall, this compound's unique structure suggests potential utility in pharmaceutical applications, particularly in the development of new therapeutic agents.
Formula:C20H20BrNO9
InChI:InChI=1/C20H20BrNO9/c1-9(23)28-8-14-16(29-10(2)24)17(30-11(3)25)15(18(21)31-14)22-19(26)12-6-4-5-7-13(12)20(22)27/h4-7,14-18H,8H2,1-3H3/t14?,15-,16+,17+,18+/m0/s1