CAS 70833-40-8
:Tert-Amyl peroxy 2-ethylhexyl carbonate
Description:
Tert-Amyl peroxy 2-ethylhexyl carbonate, with the CAS number 70833-40-8, is an organic peroxide commonly used as a radical initiator in polymerization processes. This compound is characterized by its peroxide functional group, which imparts reactivity, particularly in the presence of heat or light, leading to the generation of free radicals. It typically appears as a colorless to pale yellow liquid and has a relatively low volatility. The substance is known for its stability under normal conditions but can decompose exothermically when exposed to elevated temperatures or contaminants. Its applications extend to the production of various polymers and resins, where it facilitates the initiation of polymer chains. Safety considerations are paramount when handling this compound, as organic peroxides can pose risks such as flammability and potential for explosive decomposition. Proper storage in cool, dry conditions away from incompatible materials is essential to maintain its stability and efficacy in industrial applications.
Formula:C14H28O4
InChI:InChI=1S/C14H28O4/c1-6-9-10-12(7-2)11-16-13(15)17-18-14(4,5)8-3/h12H,6-11H2,1-5H3
InChI key:InChIKey=HTCRKQHJUYBQTK-UHFFFAOYSA-N
SMILES:C(COC(OOC(CC)(C)C)=O)(CCCC)CC
Synonyms:- Tert-Amyl peroxy 2-ethylhexyl carbonate
- Trigonox 131
- Lupersol TAEC
- Esperox C 59
- Carbonoperoxoic acid, OO-(1,1-dimethylpropyl) O-(2-ethylhexyl) ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.