CymitQuimica logo

CAS 70837-20-6

:

4-Pentynoic acid, 2-amino-, methyl ester

Description:
4-Pentynoic acid, 2-amino-, methyl ester, with the CAS number 70837-20-6, is an organic compound characterized by its alkyne functional group and an amino group. This compound features a five-carbon chain with a terminal alkyne (triple bond) and an ester functional group, which contributes to its reactivity and solubility properties. The presence of the amino group indicates that it can participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. Typically, compounds like this are used in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The methyl ester form suggests that it is likely to be a more stable and less polar derivative compared to its acid counterpart, enhancing its solubility in organic solvents. Additionally, the compound may exhibit biological activity due to the amino group, which can interact with biological systems. Overall, 4-Pentynoic acid, 2-amino-, methyl ester is a versatile compound with potential applications in various fields of chemistry and biochemistry.
Formula:C6H9NO2
InChI:InChI=1S/C6H9NO2/c1-3-4-5(7)6(8)9-2/h1,5H,4,7H2,2H3
InChI key:InChIKey=GHQXMDDXHKPECL-UHFFFAOYSA-N
SMILES:C(C(OC)=O)(CC#C)N
Synonyms:
  • Methyl 2-amino-4-pentynoate
  • 4-Pentynoic acid, 2-amino-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.