CymitQuimica logo

CAS 70842-06-7

:

5,5-dimethyl-3-[3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione

Description:
5,5-Dimethyl-3-[3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione, with the CAS number 70842-06-7, is a chemical compound characterized by its imidazolidine core structure, which features two carbonyl groups (diones) and substituents that enhance its chemical properties. The presence of the trifluoromethyl group on the phenyl ring significantly influences its reactivity and polarity, making it a compound of interest in various chemical applications, including pharmaceuticals and agrochemicals. The dimethyl groups contribute to steric hindrance, which can affect the compound's interaction with biological targets. This compound may exhibit interesting biological activities due to its structural features, and its stability can be influenced by the electronic effects of the trifluoromethyl group. Additionally, its solubility and behavior in different solvents can vary, impacting its utility in synthetic processes. Overall, 5,5-dimethyl-3-[3-(trifluoromethyl)phenyl]imidazolidine-2,4-dione is a versatile compound with potential applications in medicinal chemistry and material science.
Formula:C12H11F3N2O2
InChI:InChI=1/C12H11F3N2O2/c1-11(2)9(18)17(10(19)16-11)8-5-3-4-7(6-8)12(13,14)15/h3-6H,1-2H3,(H,16,19)
SMILES:CC1(C)C(=O)N(c2cccc(c2)C(F)(F)F)C(=N1)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.