CAS 70844-36-9
:4-(acetyl{[2-(acetylamino)-4-oxo-1,4-dihydropteridin-6-yl]methyl}amino)benzoic acid
Description:
4-(Acetyl{[2-(acetylamino)-4-oxo-1,4-dihydropteridin-6-yl]methyl}amino)benzoic acid, with the CAS number 70844-36-9, is a complex organic compound characterized by its multi-functional structure. It features a benzoic acid moiety, which contributes to its acidic properties, and a pteridine derivative that imparts unique biological activity. The presence of acetyl and amino groups suggests potential for hydrogen bonding and reactivity, making it a candidate for various chemical reactions. This compound may exhibit solubility in polar solvents due to its functional groups, while its molecular structure indicates potential interactions with biological systems, possibly influencing enzyme activity or serving as a pharmaceutical intermediate. Its specific applications may include roles in medicinal chemistry, particularly in the development of therapeutic agents targeting specific biological pathways. As with many organic compounds, its stability, reactivity, and biological activity can be influenced by environmental conditions such as pH and temperature.
Formula:C18H16N6O5
InChI:InChI=1/C18H16N6O5/c1-9(25)20-18-22-15-14(16(27)23-18)21-12(7-19-15)8-24(10(2)26)13-5-3-11(4-6-13)17(28)29/h3-7H,8H2,1-2H3,(H,28,29)(H2,19,20,22,23,25,27)
SMILES:CC(=Nc1nc2c(c(n1)O)nc(cn2)CN(C(=O)C)c1ccc(cc1)C(=O)O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.