CymitQuimica logo

CAS 70851-60-4

:

3,7,11,15-Tetramethyl-6,10,14-hexadecatrien-3-ol

Description:
3,7,11,15-Tetramethyl-6,10,14-hexadecatrien-3-ol, with the CAS number 70851-60-4, is a naturally occurring organic compound classified as a terpenoid alcohol. It features a long carbon chain with multiple double bonds, specifically three conjugated double bonds, which contribute to its reactivity and potential biological activity. The presence of hydroxyl (-OH) functional group indicates that it is an alcohol, which can participate in hydrogen bonding, influencing its solubility and volatility. This compound is typically found in certain plant species and may play a role in the plant's aroma or flavor profile. Its structure allows for various stereochemical configurations, which can affect its physical properties and interactions with biological systems. Additionally, due to its unsaturation, it may undergo oxidation or other chemical transformations under certain conditions. Overall, 3,7,11,15-Tetramethyl-6,10,14-hexadecatrien-3-ol is of interest in fields such as natural product chemistry, pharmacology, and fragrance formulation.
Formula:C20H36O
InChI:InChI=1S/C20H36O/c1-7-20(6,21)16-10-15-19(5)14-9-13-18(4)12-8-11-17(2)3/h11,13,15,21H,7-10,12,14,16H2,1-6H3
InChI key:InChIKey=SAHYANTVORDRQI-UHFFFAOYSA-N
SMILES:C(CC(CC)(C)O)C=C(CCC=C(CCC=C(C)C)C)C
Synonyms:
  • 6,10,14-Hexadecatrien-3-ol, 3,7,11,15-tetramethyl-
  • 3,7,11,15-Tetramethyl-6,10,14-hexadecatrien-3-ol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.