CAS 70857-08-8

4-[(2-methoxy-2-oxoethyl)amino]benzoic acid

Description:

4-[(2-Methoxy-2-oxoethyl)amino]benzoic acid, with the CAS number 70857-08-8, is an organic compound characterized by its aromatic structure and functional groups. It features a benzoic acid moiety, which contributes to its acidity and potential for forming hydrogen bonds. The presence of the 2-methoxy-2-oxoethyl group introduces both an ether and a carbonyl functionality, enhancing its reactivity and solubility in polar solvents. This compound is likely to exhibit moderate to high polarity due to the combination of its carboxylic acid and ether functionalities. It may participate in various chemical reactions, including nucleophilic substitutions and esterifications, making it useful in synthetic organic chemistry. Additionally, its structural characteristics suggest potential applications in pharmaceuticals or as a biochemical probe, although specific biological activities would require further investigation. Overall, 4-[(2-methoxy-2-oxoethyl)amino]benzoic acid represents a versatile compound with interesting chemical properties.

Formula: C₁₀H₁₁NO₄

InChI: InChI=1/C10H11NO4/c1-15-9(12)6-11-8-4-2-7(3-5-8)10(13)14/h2-5,11H,6H2,1H3,(H,13,14)

SMILES: COC(=O)CNc1ccc(cc1)C(=O)O

4-[(2-methoxy-2-oxoethyl)amino]benzoic acid

CAS: 70857-08-8

Formula: C₁₀H₁₁NO₄

Purity: 95.0%

Molecular weight: 209.201

Ref: 10-F315399