CAS 70857-56-6
:1,2-Bis(2-methyloctyl) 1,2-benzenedicarboxylate
Description:
1,2-Bis(2-methyloctyl) 1,2-benzenedicarboxylate, with CAS number 70857-56-6, is an organic compound classified as a diester. It features a benzene ring with two carboxylate groups (dicarboxylate) at the 1 and 2 positions, each esterified with a 2-methyloctyl group. This structure imparts several characteristics to the compound, including its relatively high molecular weight and hydrophobic nature, making it less soluble in water but more soluble in organic solvents. The presence of long alkyl chains contributes to its low volatility and potential use as a plasticizer in various polymer applications. Additionally, the compound may exhibit thermal stability and resistance to degradation, which are desirable traits in industrial applications. Its physical properties, such as melting point and boiling point, are influenced by the length and branching of the alkyl chains. Overall, 1,2-bis(2-methyloctyl) 1,2-benzenedicarboxylate is notable for its utility in enhancing the flexibility and durability of materials in which it is incorporated.
Formula:C26H42O4
InChI:InChI=1S/C26H42O4/c1-5-7-9-11-15-21(3)19-29-25(27)23-17-13-14-18-24(23)26(28)30-20-22(4)16-12-10-8-6-2/h13-14,17-18,21-22H,5-12,15-16,19-20H2,1-4H3
InChI key:InChIKey=GXRDMEGSBKPONF-UHFFFAOYSA-N
SMILES:C(OCC(CCCCCC)C)(=O)C1=C(C(OCC(CCCCCC)C)=O)C=CC=C1
Synonyms:- 1,2-Benzenedicarboxylic acid, 1,2-bis(2-methyloctyl) ester
- 1,2-Benzenedicarboxylic acid, bis(2-methyloctyl) ester
- 1,2-Bis(2-methyloctyl) 1,2-benzenedicarboxylate
- Bis(2-Methyloctyl) Benzene-1,2-Dicarboxylate
- Di(2-Methyl-1-octyl) phthalate
- Bis(2-methyloctyl) phthalate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Phthalic acid, bis-2-methyloctyl ester
CAS:Formula:C26H42O4Color and Shape:NeatMolecular weight:418.61
