CAS 70867-60-6

Benzoselenazole, 6-methoxy-2,5-dimethyl-

Description:

Benzoselenazole, 6-methoxy-2,5-dimethyl- is an organic compound characterized by its unique structure, which includes a benzoselenazole core—a bicyclic compound featuring a selenium atom in the heterocyclic ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the selenium atom. The methoxy group and the dimethyl substituents contribute to its chemical behavior, influencing solubility, polarity, and reactivity. Benzoselenazole derivatives are of interest in various fields, including materials science and medicinal chemistry, due to their potential applications in organic electronics and as pharmacophores. The presence of selenium may impart unique biological activities, making such compounds valuable for research in drug development. Additionally, the compound's physical properties, such as melting point and solubility, can vary based on the specific substituents and their arrangement, which can affect its utility in different applications. Overall, benzoselenazole, 6-methoxy-2,5-dimethyl- represents a fascinating area of study within organic chemistry.

Formula: C₁₀H₁₁NOSe

InChI: InChI=1S/C10H11NOSe/c1-6-4-8-10(5-9(6)12-3)13-7(2)11-8/h4-5H,1-3H3

InChI key: InChIKey=XHFBCBAWEIZLHY-UHFFFAOYSA-N

SMILES: O(C)C=1C=C2C(=CC1C)N=C(C)[Se]2

Synonyms:

• 6-Methoxy-2,5-Dimethyl-1,3-Benzoselenazole
• Benzoselenazole, 6-methoxy-2,5-dimethyl-
• 6-Methoxy-2,5-dimethylbenzoselenazole