CAS 70874-14-5

N-[(benzyloxy)carbonyl]alanylserinamide

Description:

N-[(benzyloxy)carbonyl]alanylserinamide, with the CAS number 70874-14-5, is a synthetic organic compound that belongs to the class of amino acid derivatives. This compound features a benzyloxycarbonyl (Z) protecting group, which is commonly used in peptide synthesis to protect the amino group of the amino acid. The structure includes an alanyl residue linked to a serinamide, indicating that it contains both an alanyl and a serine moiety. The presence of the amide functional group suggests that it has potential applications in peptide chemistry and drug development, particularly in the design of bioactive compounds. The compound is likely to exhibit properties typical of amino acids and their derivatives, such as solubility in polar solvents and potential reactivity under specific conditions. Its stability and reactivity can be influenced by the protecting groups and the overall molecular structure, making it a valuable intermediate in organic synthesis and medicinal chemistry.

Formula: C₁₄H₁₉N₃O₅

InChI: InChI=1/C14H19N3O5/c1-9(13(20)17-11(7-18)12(15)19)16-14(21)22-8-10-5-3-2-4-6-10/h2-6,9,11,18H,7-8H2,1H3,(H2,15,19)(H,16,21)(H,17,20)