CAS 70877-11-1
:(1,1,3,3-tetramethyldisiloxane-1,3-diyl)dibutane-4,1-diyl bis(2-methylprop-2-enoate)
Description:
(1,1,3,3-tetramethyldisiloxane-1,3-diyl)dibutane-4,1-diyl bis(2-methylprop-2-enoate), with CAS number 70877-11-1, is a siloxane-based compound characterized by its unique structure that includes siloxane linkages and ester functionalities. This compound typically exhibits properties such as low volatility, thermal stability, and resistance to moisture, making it suitable for various applications in coatings, adhesives, and sealants. The presence of multiple functional groups allows for potential reactivity in polymerization processes, particularly in the formation of cross-linked networks. Additionally, the bulky tetramethylsiloxane groups contribute to its hydrophobic characteristics, enhancing its performance in environments where water resistance is crucial. The compound's molecular structure suggests it may also possess good compatibility with organic solvents and other polymeric materials, further broadening its utility in industrial applications. Safety data sheets should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C20H38O5Si2
InChI:InChI=1/C20H38O5Si2/c1-17(2)19(21)23-13-9-11-15-26(5,6)25-27(7,8)16-12-10-14-24-20(22)18(3)4/h1,3,9-16H2,2,4-8H3
SMILES:C=C(C)C(=O)OCCCC[Si](C)(C)O[Si](C)(C)CCCCOC(=O)C(=C)C
Synonyms:- (1,1,3,3-Tetramethyldisiloxane-1,3-diyl)dibutane-4,1-diyl bis(2-methylacrylate)
- 2-Propenoic acid, 2-methyl-, (1,1,3,3-tetramethyl-1,3-disiloxanediyl)di-4,1-butanediyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,3 Bis(4-methacryloxybutyl)tetramethyldisiloxane
CAS:S01930 - 1,3 Bis(4-methacryloxybutyl)tetramethyldisiloxane
Formula:C20H38O5Si2Color and Shape:Liquid, ClearMolecular weight:414.689
