CAS 7089-17-0

2-{2-[4-(trifluoromethyl)phenyl]hydrazono}malononitrile

Description:

2-{2-[4-(Trifluoromethyl)phenyl]hydrazono}malononitrile, with CAS number 7089-17-0, is a chemical compound characterized by its unique structural features, including a hydrazone functional group and malononitrile moiety. This compound typically exhibits a bright color, often associated with its use as a dye or pigment in various applications. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its reactivity and stability. Additionally, the hydrazone linkage contributes to its potential as a ligand in coordination chemistry. The compound may display interesting optical properties, making it suitable for applications in organic electronics or photonic devices. Its synthesis generally involves the condensation of appropriate hydrazine derivatives with malononitrile, and it may be sensitive to light and moisture, necessitating careful handling and storage. Overall, this compound's distinctive features make it a subject of interest in both synthetic and applied chemistry.

Formula: C₁₀H₅F₃N₄

InChI: InChI=1/C10H5F3N4/c11-10(12,13)7-1-3-8(4-2-7)16-17-9(5-14)6-15/h1-4,16H

SMILES: c1cc(ccc1C(F)(F)F)NN=C(C#N)C#N

Synonyms:

• {[4-(Trifluoromethyl)Phenyl]Hydrazono}Propanedinitrile
• Propanedinitrile, 2-[2-[4-(trifluoromethyl)phenyl]hydrazinylidene]-
• 2-[[4-(trifluoromethyl)phenyl]hydrazinylidene]propanedinitrile
• 2-(2-[4-(TRIFLUOROMETHYL)PHENYL]HYDRAZONO)MALONONITRILE