CAS 70892-82-9
:N,N-Bis(2-hydroxyethyl)-4-pyridinecarboxamide
Description:
N,N-Bis(2-hydroxyethyl)-4-pyridinecarboxamide, with the CAS number 70892-82-9, is an organic compound characterized by its pyridine ring and two hydroxyethyl substituents. This compound features a carboxamide functional group, which contributes to its solubility in polar solvents and potential hydrogen bonding capabilities. The presence of the pyridine moiety imparts basic properties, allowing it to interact with various biological systems and potentially serve as a ligand in coordination chemistry. Its hydroxyethyl groups enhance its hydrophilicity, making it suitable for applications in pharmaceuticals, biochemistry, and as a potential chelating agent. The compound may exhibit moderate to high stability under standard conditions, but its reactivity can vary depending on the surrounding environment, such as pH and temperature. Overall, N,N-Bis(2-hydroxyethyl)-4-pyridinecarboxamide is of interest for its potential applications in medicinal chemistry and as a building block in the synthesis of more complex molecules.
Formula:C10H14N2O3
InChI:InChI=1S/C10H14N2O3/c13-7-5-12(6-8-14)10(15)9-1-3-11-4-2-9/h1-4,13-14H,5-8H2
InChI key:InChIKey=MTPZSDPCKPPQCT-UHFFFAOYSA-N
SMILES:N(C(=O)C=1C=CN=CC1)(CCO)CCO
Synonyms:- 4-Pyridinecarboxamide, N,N-bis(2-hydroxyethyl)-
- Isonicotinamide, N,N-bis(2-hydroxyethyl)-
- N,N-Bis(2-hydroxyethyl)-4-pyridinecarboxamide
- N,N-bis(2-hydroxyethyl)pyridine-4-carboxamide
- N,N-Bis(2-hydroxyethyl)isonicotinamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N,N-Bis(2-Hydroxyethyl)-4-pyridinecarboxamide
CAS:Formula:C10H14N2O3Color and Shape:SolidMolecular weight:210.233
