CAS 70894-72-3

N-Cyclopropyl-4-methylbenzenemethanamine

Description:

N-Cyclopropyl-4-methylbenzenemethanamine, with the CAS number 70894-72-3, is an organic compound characterized by its unique structure that includes a cyclopropyl group and a methyl-substituted aromatic ring. This compound features a primary amine functional group, which contributes to its reactivity and potential interactions in various chemical environments. The cyclopropyl moiety introduces strain and rigidity to the molecule, potentially influencing its physical and chemical properties, such as boiling point and solubility. The presence of the methyl group on the aromatic ring can enhance lipophilicity, affecting the compound's behavior in biological systems. N-Cyclopropyl-4-methylbenzenemethanamine may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its synthesis typically involves the introduction of the cyclopropyl group to a substituted benzene derivative, followed by amination. As with many amines, it may participate in hydrogen bonding, influencing its solubility in polar solvents. Overall, this compound's unique structural features suggest potential applications in drug development and materials science.

Formula: C₁₁H₁₅N

InChI: InChI=1S/C11H15N/c1-9-2-4-10(5-3-9)8-12-11-6-7-11/h2-5,11-12H,6-8H2,1H3

InChI key: InChIKey=JRPNBGMYKFLJGJ-UHFFFAOYSA-N

SMILES: N(CC1=CC=C(C)C=C1)C2CC2

Synonyms:

• N-Cyclopropyl-4-methylbenzenemethanamine
• Benzenemethanamine, N-cyclopropyl-4-methyl-