CymitQuimica logo

CAS 70894-74-5

:

N-(4-methoxybenzyl)propan-2-amine

Description:
N-(4-methoxybenzyl)propan-2-amine, also known by its CAS number 70894-74-5, is an organic compound characterized by its amine functional group and a methoxy-substituted benzyl moiety. This compound features a propan-2-amine backbone, which contributes to its basicity and potential reactivity. The presence of the methoxy group (-OCH3) on the benzyl ring enhances its lipophilicity, potentially influencing its solubility in organic solvents and biological systems. The compound may exhibit properties typical of amines, such as the ability to form salts with acids and participate in nucleophilic reactions. Additionally, due to its structural features, it may interact with biological targets, making it of interest in medicinal chemistry and pharmacology. Its synthesis and characterization would typically involve standard organic chemistry techniques, and safety precautions should be observed due to the potential for amines to be irritants or toxic. Overall, N-(4-methoxybenzyl)propan-2-amine represents a class of compounds that could have various applications in research and industry.
Formula:C11H17NO
InChI:InChI=1/C11H17NO/c1-9(2)12-8-10-4-6-11(13-3)7-5-10/h4-7,9,12H,8H2,1-3H3
InChI key:RVROZYOHWNUUNB-UHFFFAOYSA-N
SMILES:CC(C)NCc1ccc(cc1)OC
Synonyms:
  • [(4-Methoxyphenyl)Methyl](Propan-2-Yl)Amine
  • Benzenemethanamine, 4-methoxy-N-(1-methylethyl)-
  • N-(4-Methoxyphenylmethyl)isopropylamine
  • N-(4-Methoxybenzyl)propan-2-amine
Found 4 products.