CAS 70898-34-9
:O,O-dimethyl O-(2-{[(2S)-1-(methylamino)-1-oxopropan-2-yl]sulfonyl}ethyl) phosphorothioate
Description:
O,O-Dimethyl O-(2-{[(2S)-1-(methylamino)-1-oxopropan-2-yl]sulfonyl}ethyl) phosphorothioate, with CAS number 70898-34-9, is a chemical compound that belongs to the class of organophosphates. This substance is characterized by its phosphorothioate structure, which includes a phosphorus atom bonded to sulfur and oxygen atoms, contributing to its reactivity and biological activity. The presence of a sulfonyl group and a methylamino moiety indicates potential interactions with biological systems, particularly in the context of enzyme inhibition or modulation. Organophosphates are known for their applications in agriculture as pesticides and in various industrial processes. The specific stereochemistry of the compound, indicated by the (2S) configuration, suggests that it may exhibit chiral properties, which can influence its pharmacological effects. Safety considerations are paramount, as many organophosphates can be toxic to humans and wildlife, necessitating careful handling and regulation. Overall, this compound exemplifies the complexity and utility of organophosphate chemistry in both synthetic and applied contexts.
Formula:C8H18NO6PS2
InChI:InChI=1/C8H18NO6PS2/c1-7(8(10)9-2)18(11,12)6-5-15-16(17,13-3)14-4/h7H,5-6H2,1-4H3,(H,9,10)/t7-/m0/s1
SMILES:C[C@@H](C(=NC)O)S(=O)(=O)CCOP(=S)(OC)OC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
Vamidothion sulfone
CAS:Vamidothion sulfone is a biochemical.Formula:C8H18NO6PS2Color and Shape:SolidMolecular weight:319.33Vamidothion-sulfone 100 µg/mL in Acetonitrile
CAS:Controlled ProductFormula:C8H18NO6PS2Color and Shape:Single SolutionMolecular weight:319.335Vamidothion-sulfone
CAS:Controlled ProductFormula:C8H18NO6PS2Color and Shape:NeatMolecular weight:319.335Vamidothion-sulfone 1000 µg/mL in Acetonitrile
CAS:Controlled ProductFormula:C8H18NO6PS2Color and Shape:Single SolutionMolecular weight:319.335

