CAS 709-57-9
:6-chloro-2-(trifluoromethyl)pyrimidine-4,5-diamine
Description:
6-Chloro-2-(trifluoromethyl)pyrimidine-4,5-diamine is a heterocyclic organic compound characterized by its pyrimidine ring structure, which contains nitrogen atoms in the ring. The presence of a chloro group at the 6-position and a trifluoromethyl group at the 2-position significantly influences its chemical properties, including its reactivity and polarity. The compound features amino groups at the 4 and 5 positions, which can participate in hydrogen bonding and enhance its solubility in polar solvents. This compound is often utilized in pharmaceutical research and development due to its potential biological activity, particularly in the synthesis of various bioactive molecules. Its unique structural features make it a valuable intermediate in organic synthesis. Additionally, the trifluoromethyl group is known to impart unique electronic properties, which can affect the compound's interaction with biological targets. Safety data should be consulted for handling and storage, as halogenated compounds can exhibit varying degrees of toxicity and environmental impact.
Formula:C5H4ClF3N4
InChI:InChI=1/C5H4ClF3N4/c6-2-1(10)3(11)13-4(12-2)5(7,8)9/h10H2,(H2,11,12,13)
SMILES:c1(c(Cl)nc(C(F)(F)F)[nH]c1=N)N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
