CymitQuimica logo

CAS 709-70-6

:

ethyl tricyclo[2.2.1.0~2,6~]hept-3-ylcarbamate

Description:
Ethyl tricyclo[2.2.1.0^2,6]hept-3-ylcarbamate, with the CAS number 709-70-6, is a chemical compound characterized by its unique bicyclic structure, which includes a tricyclic framework. This compound features a carbamate functional group, which is indicative of its potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the ethyl group contributes to its solubility and reactivity, while the tricyclic structure may impart specific steric and electronic properties that influence its biological activity. Ethyl tricyclo[2.2.1.0^2,6]hept-3-ylcarbamate is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its stability and reactivity can be influenced by environmental factors such as temperature and pH. As with many carbamate derivatives, it may exhibit moderate toxicity, necessitating careful handling and usage in laboratory and industrial settings. Overall, this compound is of interest for its structural uniqueness and potential utility in synthetic chemistry.
Formula:C10H15NO2
InChI:InChI=1/C10H15NO2/c1-2-13-10(12)11-9-5-3-6-7(4-5)8(6)9/h5-9H,2-4H2,1H3,(H,11,12)
SMILES:CCOC(=NC1C2CC3C(C2)C13)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.