CAS 7090-25-7
:1-Naphthalenyl N-methyl-N-nitrosocarbamate
Description:
1-Naphthalenyl N-methyl-N-nitrosocarbamate, with the CAS number 7090-25-7, is a chemical compound that belongs to the class of nitrosamines, which are known for their potential carcinogenic properties. This substance features a naphthalene ring, which contributes to its aromatic characteristics, and a carbamate functional group, indicating its potential reactivity and biological activity. The presence of the nitroso group (-N=O) is significant, as it can participate in various chemical reactions, including the formation of reactive intermediates. Typically, compounds like this may exhibit low solubility in water but can dissolve in organic solvents, which influences their behavior in biological systems. Due to its structure, 1-Naphthalenyl N-methyl-N-nitrosocarbamate may be involved in metabolic processes that lead to the formation of other reactive species. Safety precautions are essential when handling this compound, as nitrosamines are often associated with health risks, including mutagenicity and carcinogenicity. Proper storage and disposal methods should be followed to mitigate any potential hazards.
Formula:C12H10N2O3
InChI:InChI=1S/C12H10N2O3/c1-14(13-16)12(15)17-11-8-4-6-9-5-2-3-7-10(9)11/h2-8H,1H3
InChI key:InChIKey=FFSXTYIBUNXZMF-UHFFFAOYSA-N
SMILES:O(C(N(N=O)C)=O)C=1C2=C(C=CC1)C=CC=C2
Synonyms:- N-Nitrosocarbaryl
- Carbamic acid, N-methyl-N-nitroso-, 1-naphthalenyl ester
- Carbamic acid, methylnitroso-, 1-naphthyl ester
- Carbamic acid, methylnitroso-, 1-naphthalenyl ester
- 1-Naphthalenyl N-methyl-N-nitrosocarbamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
