CAS 7090-41-7
:2,3,6,7-tetrachlorobiphenylene
Description:
2,3,6,7-tetrachlorobiphenylene is an organic compound characterized by its biphenylene structure, which consists of two fused benzene rings, with four chlorine atoms substituted at the 2, 3, 6, and 7 positions. This compound is typically a solid at room temperature and is known for its stability and resistance to degradation. It is often studied for its potential environmental impact, particularly in relation to its persistence and bioaccumulation in ecosystems. The presence of chlorine atoms enhances its hydrophobic properties, making it less soluble in water but more soluble in organic solvents. 2,3,6,7-tetrachlorobiphenylene is also of interest in the field of materials science and organic electronics due to its unique electronic properties. However, its toxicity and potential health effects necessitate careful handling and regulation. Overall, this compound exemplifies the complexities of halogenated organic compounds in both industrial applications and environmental chemistry.
Formula:C12H4Cl4
InChI:InChI=1/C12H4Cl4/c13-9-1-5-6(2-10(9)14)8-4-12(16)11(15)3-7(5)8/h1-4H
SMILES:c1c2c(cc(c1Cl)Cl)c1cc(c(cc21)Cl)Cl
Synonyms:- Biphenylene, 2,3,6,7-tetrachloro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2,3,6,7-Tetrachlorobiphenylene
CAS:<p>2,3,6,7-Tetrachlorobiphenylene is a potent inhibitor of kinases that are involved in cancer cell growth and proliferation. It is an analog of tolvaptan, a drug used to treat hyponatremia by increasing urine output. This compound has been shown to induce apoptosis in cancer cells and inhibit tumor growth. Studies have found that 2,3,6,7-Tetrachlorobiphenylene inhibits the activity of human protein kinases and may be effective against various types of cancer. This Chinese compound has promising anticancer properties and could potentially be used as a therapeutic agent for cancer treatment.</p>Formula:C12H4Cl4Purity:Min. 95%Molecular weight:290 g/mol
