
CAS 70900-48-0
:1,2,4-Tris[2-(2-butoxyethoxy)ethyl] 1,2,4-benzenetricarboxylate
Description:
1,2,4-Tris[2-(2-butoxyethoxy)ethyl] 1,2,4-benzenetricarboxylate, with CAS number 70900-48-0, is an organic compound characterized by its complex structure, which includes a benzene ring with three carboxylate groups and three ether-linked butoxyethyl substituents. This compound is typically used as a plasticizer or additive in various formulations, enhancing flexibility and durability in materials such as plastics and coatings. Its molecular structure contributes to its solubility in organic solvents while being relatively stable under normal conditions. The presence of multiple ether linkages provides good thermal stability and resistance to hydrolysis. Additionally, the compound may exhibit low volatility, making it suitable for applications where evaporation is a concern. Safety data sheets should be consulted for handling and toxicity information, as with any chemical substance, to ensure proper safety measures are taken during use. Overall, this compound is valued in industrial applications for its performance-enhancing properties.
Formula:C33H54O12
InChI:InChI=1S/C33H54O12/c1-4-7-12-37-15-18-40-21-24-43-31(34)28-10-11-29(32(35)44-25-22-41-19-16-38-13-8-5-2)30(27-28)33(36)45-26-23-42-20-17-39-14-9-6-3/h10-11,27H,4-9,12-26H2,1-3H3
InChI key:InChIKey=DWDGWZYISJOICD-UHFFFAOYSA-N
SMILES:C(OCCOCCOCCCC)(=O)C1=C(C(OCCOCCOCCCC)=O)C=CC(C(OCCOCCOCCCC)=O)=C1
Synonyms:- 1,2,4-Tris[2-(2-butoxyethoxy)ethyl] 1,2,4-benzenetricarboxylate
- 1,2,4-Benzenetricarboxylic acid, 1,2,4-tris[2-(2-butoxyethoxy)ethyl] ester
- 1,2,4-Benzenetricarboxylic acid, tris[2-(2-butoxyethoxy)ethyl] ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,2,4-Benzenetricarboxylicacid, 1,2,4-tris[2-(2-butoxyethoxy)ethyl] ester
CAS:Formula:C33H54O12Molecular weight:642.7747
